C19H24F3N5OS — CID 112824707
1-(5-methyl-1,3-thiazol-2-yl)-3-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]urea (PubChem CID 112824707) has the molecular formula C19H24F3N5OS and a molecular weight of 427.50 g/mol. Its IUPAC name is 1-(5-methyl-1,3-thiazol-2-yl)-3-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]urea.
| Compound Name | 1-(5-methyl-1,3-thiazol-2-yl)-3-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]urea |
|---|---|
| PubChem CID | 112824707 |
| Molecular Formula | C19H24F3N5OS |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 1-(5-methyl-1,3-thiazol-2-yl)-3-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]urea |
| SMILES | Cc1cnc(NC(=O)NCCCN2CCN(c3cccc(C(F)(F)F)c3)CC2)s1 |
| InChI | InChI=1S/C19H24F3N5OS/c1-14-13-24-18(29-14)25-17(28)23-6-3-7-26-8-10-27(11-9-26)16-5-2-4-15(12-16)19(20,21)22/h2,4-5,12-13H,3,6-11H2,1H3,(H2,23,24,25,28) |
| InChIKey | VVBCNIWZADTPSS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|