C23H35F3N4O3 — CID 55683557
tert-butyl N-[4-oxo-4-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propylamino]butyl]carbamate (PubChem CID 55683557) has the molecular formula C23H35F3N4O3 and a molecular weight of 472.55 g/mol. Its IUPAC name is tert-butyl N-[4-oxo-4-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propylamino]butyl]carbamate.
| Compound Name | tert-butyl N-[4-oxo-4-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propylamino]butyl]carbamate |
|---|---|
| PubChem CID | 55683557 |
| Molecular Formula | C23H35F3N4O3 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | tert-butyl N-[4-oxo-4-[3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propylamino]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC(=O)NCCCN1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C23H35F3N4O3/c1-22(2,3)33-21(32)28-10-5-9-20(31)27-11-6-12-29-13-15-30(16-14-29)19-8-4-7-18(17-19)23(24,25)26/h4,7-8,17H,5-6,9-16H2,1-3H3,(H,27,31)(H,28,32) |
| InChIKey | JYWPIWQKWULOBD-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|