C19H24F3N3O5 — CID 15942812
(Z)-but-2-enedioic acid;N-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]acetamide (PubChem CID 15942812) has the molecular formula C19H24F3N3O5 and a molecular weight of 431.41 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;N-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]acetamide.
| Compound Name | (Z)-but-2-enedioic acid;N-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 15942812 |
| Molecular Formula | C19H24F3N3O5 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | (Z)-but-2-enedioic acid;N-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]acetamide |
| SMILES | CC(=O)NCCN1CCN(c2cccc(C(F)(F)F)c2)CC1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C15H20F3N3O.C4H4O4/c1-12(22)19-5-6-20-7-9-21(10-8-20)14-4-2-3-13(11-14)15(16,17)18;5-3(6)1-2-4(7)8/h2-4,11H,5-10H2,1H3,(H,19,22);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | CKJJFJVADCTDRB-BTJKTKAUSA-N |
| XLogP | 1.68 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|