C18H24F3N3O8 — CID 163332625
oxalic acid;3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propan-1-amine (PubChem CID 163332625) has the molecular formula C18H24F3N3O8 and a molecular weight of 467.40 g/mol. Its IUPAC name is oxalic acid;3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propan-1-amine.
| Compound Name | oxalic acid;3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propan-1-amine |
|---|---|
| PubChem CID | 163332625 |
| Molecular Formula | C18H24F3N3O8 |
| Molecular Weight | 467.40 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | oxalic acid;3-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]propan-1-amine |
| SMILES | NCCCN1CCN(c2cccc(C(F)(F)F)c2)CC1.O=C(O)C(=O)O.O=C(O)C(=O)O |
| InChI | InChI=1S/C14H20F3N3.2C2H2O4/c15-14(16,17)12-3-1-4-13(11-12)20-9-7-19(8-10-20)6-2-5-18;2*3-1(4)2(5)6/h1,3-4,11H,2,5-10,18H2;2*(H,3,4)(H,5,6) |
| InChIKey | PNGMHBGPQSATMN-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 181.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.40 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|