C29H31F3N2O6S — CID 22763809
1-[4-(benzenesulfonyl)-4-phenylbutyl]-4-[3-(trifluoromethyl)phenyl]piperazine;oxalic acid (PubChem CID 22763809) has the molecular formula C29H31F3N2O6S and a molecular weight of 592.64 g/mol. Its IUPAC name is 1-[4-(benzenesulfonyl)-4-phenylbutyl]-4-[3-(trifluoromethyl)phenyl]piperazine;oxalic acid.
| Compound Name | 1-[4-(benzenesulfonyl)-4-phenylbutyl]-4-[3-(trifluoromethyl)phenyl]piperazine;oxalic acid |
|---|---|
| PubChem CID | 22763809 |
| Molecular Formula | C29H31F3N2O6S |
| Molecular Weight | 592.64 g/mol |
| Exact Mass | 592.19 |
| IUPAC Name | 1-[4-(benzenesulfonyl)-4-phenylbutyl]-4-[3-(trifluoromethyl)phenyl]piperazine;oxalic acid |
| SMILES | O=C(O)C(=O)O.O=S(=O)(c1ccccc1)C(CCCN1CCN(c2cccc(C(F)(F)F)c2)CC1)c1ccccc1 |
| InChI | InChI=1S/C27H29F3N2O2S.C2H2O4/c28-27(29,30)23-11-7-12-24(21-23)32-19-17-31(18-20-32)16-8-15-26(22-9-3-1-4-10-22)35(33,34)25-13-5-2-6-14-25;3-1(4)2(5)6/h1-7,9-14,21,26H,8,15-20H2;(H,3,4)(H,5,6) |
| InChIKey | STVLJASUIANVQK-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.64 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|