C19H22ClF3N2 — CID 76852194
1-(2-phenylethyl)-4-[3-(trifluoromethyl)phenyl]piperazine;hydrochloride (PubChem CID 76852194) has the molecular formula C19H22ClF3N2 and a molecular weight of 370.85 g/mol. Its IUPAC name is 1-(2-phenylethyl)-4-[3-(trifluoromethyl)phenyl]piperazine;hydrochloride.
| Compound Name | 1-(2-phenylethyl)-4-[3-(trifluoromethyl)phenyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 76852194 |
| Molecular Formula | C19H22ClF3N2 |
| Molecular Weight | 370.85 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 1-(2-phenylethyl)-4-[3-(trifluoromethyl)phenyl]piperazine;hydrochloride |
| SMILES | Cl.FC(F)(F)c1cccc(N2CCN(CCc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C19H21F3N2.ClH/c20-19(21,22)17-7-4-8-18(15-17)24-13-11-23(12-14-24)10-9-16-5-2-1-3-6-16;/h1-8,15H,9-14H2;1H |
| InChIKey | AEVKKQKSKNZLNU-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.85 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |