C19H18F6N2 — CID 18761081
1-[3-(trifluoromethyl)phenyl]-4-[[3-(trifluoromethyl)phenyl]methyl]piperazine (PubChem CID 18761081) has the molecular formula C19H18F6N2 and a molecular weight of 388.36 g/mol. Its IUPAC name is 1-[3-(trifluoromethyl)phenyl]-4-[[3-(trifluoromethyl)phenyl]methyl]piperazine.
| Compound Name | 1-[3-(trifluoromethyl)phenyl]-4-[[3-(trifluoromethyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 18761081 |
| Molecular Formula | C19H18F6N2 |
| Molecular Weight | 388.36 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 1-[3-(trifluoromethyl)phenyl]-4-[[3-(trifluoromethyl)phenyl]methyl]piperazine |
| SMILES | FC(F)(F)c1cccc(CN2CCN(c3cccc(C(F)(F)F)c3)CC2)c1 |
| InChI | InChI=1S/C19H18F6N2/c20-18(21,22)15-4-1-3-14(11-15)13-26-7-9-27(10-8-26)17-6-2-5-16(12-17)19(23,24)25/h1-6,11-12H,7-10,13H2 |
| InChIKey | GQPAEQJNGKMANH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.36 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |