C12H17Cl2F3N2 — CID 13458726
1-[[3-(trifluoromethyl)phenyl]methyl]piperazine;dihydrochloride (PubChem CID 13458726) has the molecular formula C12H17Cl2F3N2 and a molecular weight of 317.18 g/mol. Its IUPAC name is 1-[[3-(trifluoromethyl)phenyl]methyl]piperazine;dihydrochloride.
| Compound Name | 1-[[3-(trifluoromethyl)phenyl]methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 13458726 |
| Molecular Formula | C12H17Cl2F3N2 |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 1-[[3-(trifluoromethyl)phenyl]methyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.FC(F)(F)c1cccc(CN2CCNCC2)c1 |
| InChI | InChI=1S/C12H15F3N2.2ClH/c13-12(14,15)11-3-1-2-10(8-11)9-17-6-4-16-5-7-17;;/h1-3,8,16H,4-7,9H2;2*1H |
| InChIKey | HLBFPJCANSSFGS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |