C14H17F5N2 — CID 90760326
1-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-1,4-diazepane (PubChem CID 90760326) has the molecular formula C14H17F5N2 and a molecular weight of 308.29 g/mol. Its IUPAC name is 1-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-1,4-diazepane.
| Compound Name | 1-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 90760326 |
| Molecular Formula | C14H17F5N2 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 1-[[3-(1,1,2,2,2-pentafluoroethyl)phenyl]methyl]-1,4-diazepane |
| SMILES | FC(F)(F)C(F)(F)c1cccc(CN2CCCNCC2)c1 |
| InChI | InChI=1S/C14H17F5N2/c15-13(16,14(17,18)19)12-4-1-3-11(9-12)10-21-7-2-5-20-6-8-21/h1,3-4,9,20H,2,5-8,10H2 |
| InChIKey | DYAJYYXJWIVQLN-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|