C14H17F5N2O — CID 90744038
1-[[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]methyl]-1,4-diazepane (PubChem CID 90744038) has the molecular formula C14H17F5N2O and a molecular weight of 324.29 g/mol. Its IUPAC name is 1-[[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]methyl]-1,4-diazepane.
| Compound Name | 1-[[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 90744038 |
| Molecular Formula | C14H17F5N2O |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 1-[[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]methyl]-1,4-diazepane |
| SMILES | FC(F)(F)C(F)(F)Oc1ccc(CN2CCCNCC2)cc1 |
| InChI | InChI=1S/C14H17F5N2O/c15-13(16,17)14(18,19)22-12-4-2-11(3-5-12)10-21-8-1-6-20-7-9-21/h2-5,20H,1,6-10H2 |
| InChIKey | NQXSQOBOOMJBCF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|