C17H22F5NO — CID 89411330
1-[[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]methyl]-4-propan-2-ylpiperidine (PubChem CID 89411330) has the molecular formula C17H22F5NO and a molecular weight of 351.36 g/mol. Its IUPAC name is 1-[[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]methyl]-4-propan-2-ylpiperidine.
| Compound Name | 1-[[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]methyl]-4-propan-2-ylpiperidine |
|---|---|
| PubChem CID | 89411330 |
| Molecular Formula | C17H22F5NO |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 1-[[4-(1,1,2,2,2-pentafluoroethoxy)phenyl]methyl]-4-propan-2-ylpiperidine |
| SMILES | CC(C)C1CCN(Cc2ccc(OC(F)(F)C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C17H22F5NO/c1-12(2)14-7-9-23(10-8-14)11-13-3-5-15(6-4-13)24-17(21,22)16(18,19)20/h3-6,12,14H,7-11H2,1-2H3 |
| InChIKey | GVLALEZUPPGKES-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|