C19H22ClF3N2O — CID 175576430
2-chloro-1-methyl-4-[1-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]-4H-pyridine (PubChem CID 175576430) has the molecular formula C19H22ClF3N2O and a molecular weight of 386.85 g/mol. Its IUPAC name is 2-chloro-1-methyl-4-[1-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]-4H-pyridine.
| Compound Name | 2-chloro-1-methyl-4-[1-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]-4H-pyridine |
|---|---|
| PubChem CID | 175576430 |
| Molecular Formula | C19H22ClF3N2O |
| Molecular Weight | 386.85 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 2-chloro-1-methyl-4-[1-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]-4H-pyridine |
| SMILES | CN1C=CC(C2CCN(Cc3ccc(OC(F)(F)F)cc3)CC2)C=C1Cl |
| InChI | InChI=1S/C19H22ClF3N2O/c1-24-9-6-16(12-18(24)20)15-7-10-25(11-8-15)13-14-2-4-17(5-3-14)26-19(21,22)23/h2-6,9,12,15-16H,7-8,10-11,13H2,1H3 |
| InChIKey | MRUAGHBNNWIDTG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.85 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|