C16H20F3NO4 — CID 177337432
2-methoxy-2-[1-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]acetic acid (PubChem CID 177337432) has the molecular formula C16H20F3NO4 and a molecular weight of 347.33 g/mol. Its IUPAC name is 2-methoxy-2-[1-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-methoxy-2-[1-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 177337432 |
| Molecular Formula | C16H20F3NO4 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 2-methoxy-2-[1-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]acetic acid |
| SMILES | COC(C(=O)O)C1CCN(Cc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C16H20F3NO4/c1-23-14(15(21)22)12-6-8-20(9-7-12)10-11-2-4-13(5-3-11)24-16(17,18)19/h2-5,12,14H,6-10H2,1H3,(H,21,22) |
| InChIKey | OEOMOKJMSZJJOX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |