C18H24F3N3O4 — CID 87460981
methylamino-[3-oxo-1-[1-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]propyl]carbamic acid (PubChem CID 87460981) has the molecular formula C18H24F3N3O4 and a molecular weight of 403.40 g/mol. Its IUPAC name is methylamino-[3-oxo-1-[1-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]propyl]carbamic acid.
| Compound Name | methylamino-[3-oxo-1-[1-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]propyl]carbamic acid |
|---|---|
| PubChem CID | 87460981 |
| Molecular Formula | C18H24F3N3O4 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | methylamino-[3-oxo-1-[1-[[4-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]propyl]carbamic acid |
| SMILES | CNN(C(=O)O)C(CC=O)C1CCN(Cc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C18H24F3N3O4/c1-22-24(17(26)27)16(8-11-25)14-6-9-23(10-7-14)12-13-2-4-15(5-3-13)28-18(19,20)21/h2-5,11,14,16,22H,6-10,12H2,1H3,(H,26,27) |
| InChIKey | GHPATUSNQLVHAM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|