C15H20F3N3 — CID 66202708
1-(azetidin-3-yl)-4-[[3-(trifluoromethyl)phenyl]methyl]piperazine (PubChem CID 66202708) has the molecular formula C15H20F3N3 and a molecular weight of 299.34 g/mol. Its IUPAC name is 1-(azetidin-3-yl)-4-[[3-(trifluoromethyl)phenyl]methyl]piperazine.
| Compound Name | 1-(azetidin-3-yl)-4-[[3-(trifluoromethyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 66202708 |
| Molecular Formula | C15H20F3N3 |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 1-(azetidin-3-yl)-4-[[3-(trifluoromethyl)phenyl]methyl]piperazine |
| SMILES | FC(F)(F)c1cccc(CN2CCN(C3CNC3)CC2)c1 |
| InChI | InChI=1S/C15H20F3N3/c16-15(17,18)13-3-1-2-12(8-13)11-20-4-6-21(7-5-20)14-9-19-10-14/h1-3,8,14,19H,4-7,9-11H2 |
| InChIKey | JSBZHBPNYIRHCV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |