C16H21F3N2 — CID 52878093
(3S)-3-pyrrolidin-1-yl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine (PubChem CID 52878093) has the molecular formula C16H21F3N2 and a molecular weight of 298.35 g/mol. Its IUPAC name is (3S)-3-pyrrolidin-1-yl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine.
| Compound Name | (3S)-3-pyrrolidin-1-yl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine |
|---|---|
| PubChem CID | 52878093 |
| Molecular Formula | C16H21F3N2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | (3S)-3-pyrrolidin-1-yl-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine |
| SMILES | FC(F)(F)c1cccc(CN2CC[C@H](N3CCCC3)C2)c1 |
| InChI | InChI=1S/C16H21F3N2/c17-16(18,19)14-5-3-4-13(10-14)11-20-9-6-15(12-20)21-7-1-2-8-21/h3-5,10,15H,1-2,6-9,11-12H2/t15-/m0/s1 |
| InChIKey | WGRRWEGLTNDWPS-HNNXBMFYSA-N |
| XLogP | 3.38 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |