C12H13BrF3N — CID 80677072
3-bromo-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine (PubChem CID 80677072) has the molecular formula C12H13BrF3N and a molecular weight of 308.14 g/mol. Its IUPAC name is 3-bromo-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine.
| Compound Name | 3-bromo-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine |
|---|---|
| PubChem CID | 80677072 |
| Molecular Formula | C12H13BrF3N |
| Molecular Weight | 308.14 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 3-bromo-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine |
| SMILES | FC(F)(F)c1cccc(CN2CCC(Br)C2)c1 |
| InChI | InChI=1S/C12H13BrF3N/c13-11-4-5-17(8-11)7-9-2-1-3-10(6-9)12(14,15)16/h1-3,6,11H,4-5,7-8H2 |
| InChIKey | ZKCJFYPMDJOBDF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.14 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|