C19H21ClF3NO — CID 117068516
4-phenoxy-1-[[3-(trifluoromethyl)phenyl]methyl]piperidine;hydrochloride (PubChem CID 117068516) has the molecular formula C19H21ClF3NO and a molecular weight of 371.83 g/mol. Its IUPAC name is 4-phenoxy-1-[[3-(trifluoromethyl)phenyl]methyl]piperidine;hydrochloride.
| Compound Name | 4-phenoxy-1-[[3-(trifluoromethyl)phenyl]methyl]piperidine;hydrochloride |
|---|---|
| PubChem CID | 117068516 |
| Molecular Formula | C19H21ClF3NO |
| Molecular Weight | 371.83 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 4-phenoxy-1-[[3-(trifluoromethyl)phenyl]methyl]piperidine;hydrochloride |
| SMILES | Cl.FC(F)(F)c1cccc(CN2CCC(Oc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C19H20F3NO.ClH/c20-19(21,22)16-6-4-5-15(13-16)14-23-11-9-18(10-12-23)24-17-7-2-1-3-8-17;/h1-8,13,18H,9-12,14H2;1H |
| InChIKey | XVSQOZJCKVRWFW-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.83 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |