C20H29F3N2O — CID 68903645
4-[2-[4-[3-(trifluoromethyl)phenoxy]piperidin-1-yl]ethyl]cyclohexan-1-amine (PubChem CID 68903645) has the molecular formula C20H29F3N2O and a molecular weight of 370.46 g/mol. Its IUPAC name is 4-[2-[4-[3-(trifluoromethyl)phenoxy]piperidin-1-yl]ethyl]cyclohexan-1-amine.
| Compound Name | 4-[2-[4-[3-(trifluoromethyl)phenoxy]piperidin-1-yl]ethyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 68903645 |
| Molecular Formula | C20H29F3N2O |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | 4-[2-[4-[3-(trifluoromethyl)phenoxy]piperidin-1-yl]ethyl]cyclohexan-1-amine |
| SMILES | NC1CCC(CCN2CCC(Oc3cccc(C(F)(F)F)c3)CC2)CC1 |
| InChI | InChI=1S/C20H29F3N2O/c21-20(22,23)16-2-1-3-19(14-16)26-18-9-12-25(13-10-18)11-8-15-4-6-17(24)7-5-15/h1-3,14-15,17-18H,4-13,24H2 |
| InChIKey | MSTBAJISQORGMO-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |