C21H24F3NO — CID 23294464
4-benzyl-1-[2-[3-(trifluoromethyl)phenoxy]ethyl]piperidine (PubChem CID 23294464) has the molecular formula C21H24F3NO and a molecular weight of 363.42 g/mol. Its IUPAC name is 4-benzyl-1-[2-[3-(trifluoromethyl)phenoxy]ethyl]piperidine.
| Compound Name | 4-benzyl-1-[2-[3-(trifluoromethyl)phenoxy]ethyl]piperidine |
|---|---|
| PubChem CID | 23294464 |
| Molecular Formula | C21H24F3NO |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 4-benzyl-1-[2-[3-(trifluoromethyl)phenoxy]ethyl]piperidine |
| SMILES | FC(F)(F)c1cccc(OCCN2CCC(Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C21H24F3NO/c22-21(23,24)19-7-4-8-20(16-19)26-14-13-25-11-9-18(10-12-25)15-17-5-2-1-3-6-17/h1-8,16,18H,9-15H2 |
| InChIKey | VWUHMMQVNJLNKY-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |