C27H30N2O3 — CID 15952046
[4-[2-(4-benzylpiperidin-1-yl)ethoxy]phenyl] N-phenylcarbamate (PubChem CID 15952046) has the molecular formula C27H30N2O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is [4-[2-(4-benzylpiperidin-1-yl)ethoxy]phenyl] N-phenylcarbamate.
| Compound Name | [4-[2-(4-benzylpiperidin-1-yl)ethoxy]phenyl] N-phenylcarbamate |
|---|---|
| PubChem CID | 15952046 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | [4-[2-(4-benzylpiperidin-1-yl)ethoxy]phenyl] N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)Oc1ccc(OCCN2CCC(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C27H30N2O3/c30-27(28-24-9-5-2-6-10-24)32-26-13-11-25(12-14-26)31-20-19-29-17-15-23(16-18-29)21-22-7-3-1-4-8-22/h1-14,23H,15-21H2,(H,28,30) |
| InChIKey | YWRFBFASVZTBPR-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |