C22H26F3NO — CID 42691442
1-[(3-ethoxyphenyl)methyl]-4-[[4-(trifluoromethyl)phenyl]methyl]piperidine (PubChem CID 42691442) has the molecular formula C22H26F3NO and a molecular weight of 377.45 g/mol. Its IUPAC name is 1-[(3-ethoxyphenyl)methyl]-4-[[4-(trifluoromethyl)phenyl]methyl]piperidine.
| Compound Name | 1-[(3-ethoxyphenyl)methyl]-4-[[4-(trifluoromethyl)phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 42691442 |
| Molecular Formula | C22H26F3NO |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 1-[(3-ethoxyphenyl)methyl]-4-[[4-(trifluoromethyl)phenyl]methyl]piperidine |
| SMILES | CCOc1cccc(CN2CCC(Cc3ccc(C(F)(F)F)cc3)CC2)c1 |
| InChI | InChI=1S/C22H26F3NO/c1-2-27-21-5-3-4-19(15-21)16-26-12-10-18(11-13-26)14-17-6-8-20(9-7-17)22(23,24)25/h3-9,15,18H,2,10-14,16H2,1H3 |
| InChIKey | AKCHNMKWBWTQAB-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |