C23H27F3N2O3 — CID 86812682
2-(4-ethoxyphenoxy)-N-[1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]acetamide (PubChem CID 86812682) has the molecular formula C23H27F3N2O3 and a molecular weight of 436.47 g/mol. Its IUPAC name is 2-(4-ethoxyphenoxy)-N-[1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]acetamide.
| Compound Name | 2-(4-ethoxyphenoxy)-N-[1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 86812682 |
| Molecular Formula | C23H27F3N2O3 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 2-(4-ethoxyphenoxy)-N-[1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]acetamide |
| SMILES | CCOc1ccc(OCC(=O)NC2CCN(Cc3cccc(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C23H27F3N2O3/c1-2-30-20-6-8-21(9-7-20)31-16-22(29)27-19-10-12-28(13-11-19)15-17-4-3-5-18(14-17)23(24,25)26/h3-9,14,19H,2,10-13,15-16H2,1H3,(H,27,29) |
| InChIKey | KZEJEAAEANIVRY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |