C22H25F3N2O2 — CID 55945762
3-ethoxy-N-[1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]benzamide (PubChem CID 55945762) has the molecular formula C22H25F3N2O2 and a molecular weight of 406.45 g/mol. Its IUPAC name is 3-ethoxy-N-[1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]benzamide.
| Compound Name | 3-ethoxy-N-[1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 55945762 |
| Molecular Formula | C22H25F3N2O2 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 3-ethoxy-N-[1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]benzamide |
| SMILES | CCOc1cccc(C(=O)NC2CCN(Cc3cccc(C(F)(F)F)c3)CC2)c1 |
| InChI | InChI=1S/C22H25F3N2O2/c1-2-29-20-8-4-6-17(14-20)21(28)26-19-9-11-27(12-10-19)15-16-5-3-7-18(13-16)22(23,24)25/h3-8,13-14,19H,2,9-12,15H2,1H3,(H,26,28) |
| InChIKey | ZFSPYMVFQQWSCZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |