C25H24F3N3O2 — CID 12942336
N-[[1-(naphthalen-2-ylmethyl)piperidin-4-yl]carbamoyl]-3-(trifluoromethyl)benzamide (PubChem CID 12942336) has the molecular formula C25H24F3N3O2 and a molecular weight of 455.48 g/mol. Its IUPAC name is N-[[1-(naphthalen-2-ylmethyl)piperidin-4-yl]carbamoyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[[1-(naphthalen-2-ylmethyl)piperidin-4-yl]carbamoyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 12942336 |
| Molecular Formula | C25H24F3N3O2 |
| Molecular Weight | 455.48 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | N-[[1-(naphthalen-2-ylmethyl)piperidin-4-yl]carbamoyl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(NC(=O)c1cccc(C(F)(F)F)c1)NC1CCN(Cc2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C25H24F3N3O2/c26-25(27,28)21-7-3-6-20(15-21)23(32)30-24(33)29-22-10-12-31(13-11-22)16-17-8-9-18-4-1-2-5-19(18)14-17/h1-9,14-15,22H,10-13,16H2,(H2,29,30,32,33) |
| InChIKey | SWSAYPIRSHRZIP-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.48 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |