C28H31F3N2O4 — CID 24954046
N-[1-[[7-(2-methoxyethoxymethyl)naphthalen-2-yl]methyl]piperidin-4-yl]-3-(trifluoromethoxy)benzamide (PubChem CID 24954046) has the molecular formula C28H31F3N2O4 and a molecular weight of 516.56 g/mol. Its IUPAC name is N-[1-[[7-(2-methoxyethoxymethyl)naphthalen-2-yl]methyl]piperidin-4-yl]-3-(trifluoromethoxy)benzamide.
| Compound Name | N-[1-[[7-(2-methoxyethoxymethyl)naphthalen-2-yl]methyl]piperidin-4-yl]-3-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 24954046 |
| Molecular Formula | C28H31F3N2O4 |
| Molecular Weight | 516.56 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | N-[1-[[7-(2-methoxyethoxymethyl)naphthalen-2-yl]methyl]piperidin-4-yl]-3-(trifluoromethoxy)benzamide |
| SMILES | COCCOCc1ccc2ccc(CN3CCC(NC(=O)c4cccc(OC(F)(F)F)c4)CC3)cc2c1 |
| InChI | InChI=1S/C28H31F3N2O4/c1-35-13-14-36-19-21-6-8-22-7-5-20(15-24(22)16-21)18-33-11-9-25(10-12-33)32-27(34)23-3-2-4-26(17-23)37-28(29,30)31/h2-8,15-17,25H,9-14,18-19H2,1H3,(H,32,34) |
| InChIKey | STGOMGALAQAFKA-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.56 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|