C28H35BrN2O4 — CID 68524871
3-methoxy-N-[1-[[7-(2-methoxyethoxymethyl)naphthalen-2-yl]methyl]piperidin-4-yl]benzamide;hydrobromide (PubChem CID 68524871) has the molecular formula C28H35BrN2O4 and a molecular weight of 543.50 g/mol. Its IUPAC name is 3-methoxy-N-[1-[[7-(2-methoxyethoxymethyl)naphthalen-2-yl]methyl]piperidin-4-yl]benzamide;hydrobromide.
| Compound Name | 3-methoxy-N-[1-[[7-(2-methoxyethoxymethyl)naphthalen-2-yl]methyl]piperidin-4-yl]benzamide;hydrobromide |
|---|---|
| PubChem CID | 68524871 |
| Molecular Formula | C28H35BrN2O4 |
| Molecular Weight | 543.50 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | 3-methoxy-N-[1-[[7-(2-methoxyethoxymethyl)naphthalen-2-yl]methyl]piperidin-4-yl]benzamide;hydrobromide |
| SMILES | Br.COCCOCc1ccc2ccc(CN3CCC(NC(=O)c4cccc(OC)c4)CC3)cc2c1 |
| InChI | InChI=1S/C28H34N2O4.BrH/c1-32-14-15-34-20-22-7-9-23-8-6-21(16-25(23)17-22)19-30-12-10-26(11-13-30)29-28(31)24-4-3-5-27(18-24)33-2;/h3-9,16-18,26H,10-15,19-20H2,1-2H3,(H,29,31);1H |
| InChIKey | QQYLDHXDJBTOQB-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|