C29H34N2O5 — CID 68972696
[3-[[1-[[7-(2-methoxyethoxymethyl)naphthalen-2-yl]methyl]piperidin-4-yl]carbamoyl]phenyl] acetate (PubChem CID 68972696) has the molecular formula C29H34N2O5 and a molecular weight of 490.60 g/mol. Its IUPAC name is [3-[[1-[[7-(2-methoxyethoxymethyl)naphthalen-2-yl]methyl]piperidin-4-yl]carbamoyl]phenyl] acetate.
| Compound Name | [3-[[1-[[7-(2-methoxyethoxymethyl)naphthalen-2-yl]methyl]piperidin-4-yl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 68972696 |
| Molecular Formula | C29H34N2O5 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | [3-[[1-[[7-(2-methoxyethoxymethyl)naphthalen-2-yl]methyl]piperidin-4-yl]carbamoyl]phenyl] acetate |
| SMILES | COCCOCc1ccc2ccc(CN3CCC(NC(=O)c4cccc(OC(C)=O)c4)CC3)cc2c1 |
| InChI | InChI=1S/C29H34N2O5/c1-21(32)36-28-5-3-4-25(18-28)29(33)30-27-10-12-31(13-11-27)19-22-6-8-24-9-7-23(17-26(24)16-22)20-35-15-14-34-2/h3-9,16-18,27H,10-15,19-20H2,1-2H3,(H,30,33) |
| InChIKey | CSPOWBXNLPMVTK-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|