C25H36N2O4 — CID 90836588
tert-butyl N-[1-[[7-(2-methoxyethoxymethyl)naphthalen-2-yl]methyl]piperidin-4-yl]carbamate (PubChem CID 90836588) has the molecular formula C25H36N2O4 and a molecular weight of 428.57 g/mol. Its IUPAC name is tert-butyl N-[1-[[7-(2-methoxyethoxymethyl)naphthalen-2-yl]methyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[7-(2-methoxyethoxymethyl)naphthalen-2-yl]methyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 90836588 |
| Molecular Formula | C25H36N2O4 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | tert-butyl N-[1-[[7-(2-methoxyethoxymethyl)naphthalen-2-yl]methyl]piperidin-4-yl]carbamate |
| SMILES | COCCOCc1ccc2ccc(CN3CCC(NC(=O)OC(C)(C)C)CC3)cc2c1 |
| InChI | InChI=1S/C25H36N2O4/c1-25(2,3)31-24(28)26-23-9-11-27(12-10-23)17-19-5-7-21-8-6-20(16-22(21)15-19)18-30-14-13-29-4/h5-8,15-16,23H,9-14,17-18H2,1-4H3,(H,26,28) |
| InChIKey | CSFWXSBYKXWLQC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|