C28H33N3O4 — CID 68529595
3-N-[1-[[7-(2-methoxyethoxymethyl)naphthalen-2-yl]methyl]piperidin-4-yl]benzene-1,3-dicarboxamide (PubChem CID 68529595) has the molecular formula C28H33N3O4 and a molecular weight of 475.59 g/mol. Its IUPAC name is 3-N-[1-[[7-(2-methoxyethoxymethyl)naphthalen-2-yl]methyl]piperidin-4-yl]benzene-1,3-dicarboxamide.
| Compound Name | 3-N-[1-[[7-(2-methoxyethoxymethyl)naphthalen-2-yl]methyl]piperidin-4-yl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 68529595 |
| Molecular Formula | C28H33N3O4 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | 3-N-[1-[[7-(2-methoxyethoxymethyl)naphthalen-2-yl]methyl]piperidin-4-yl]benzene-1,3-dicarboxamide |
| SMILES | COCCOCc1ccc2ccc(CN3CCC(NC(=O)c4cccc(C(N)=O)c4)CC3)cc2c1 |
| InChI | InChI=1S/C28H33N3O4/c1-34-13-14-35-19-21-6-8-22-7-5-20(15-25(22)16-21)18-31-11-9-26(10-12-31)30-28(33)24-4-2-3-23(17-24)27(29)32/h2-8,15-17,26H,9-14,18-19H2,1H3,(H2,29,32)(H,30,33) |
| InChIKey | SEYSJQDNSCIYOO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|