C14H18F3N3O2 — CID 75439246
[1-[[3-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]urea (PubChem CID 75439246) has the molecular formula C14H18F3N3O2 and a molecular weight of 317.31 g/mol. Its IUPAC name is [1-[[3-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]urea.
| Compound Name | [1-[[3-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]urea |
|---|---|
| PubChem CID | 75439246 |
| Molecular Formula | C14H18F3N3O2 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | [1-[[3-(trifluoromethoxy)phenyl]methyl]piperidin-4-yl]urea |
| SMILES | NC(=O)NC1CCN(Cc2cccc(OC(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C14H18F3N3O2/c15-14(16,17)22-12-3-1-2-10(8-12)9-20-6-4-11(5-7-20)19-13(18)21/h1-3,8,11H,4-7,9H2,(H3,18,19,21) |
| InChIKey | ZKNPCIRUOMOKKQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |