C19H27BCl2F3NO3 — CID 174928959
CID 174928959 (PubChem CID 174928959) has the molecular formula C19H27BCl2F3NO3 and a molecular weight of 456.14 g/mol.
| Compound Name | CID 174928959 |
|---|---|
| PubChem CID | 174928959 |
| Molecular Formula | C19H27BCl2F3NO3 |
| Molecular Weight | 456.14 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | — |
| SMILES | Cl.Cl.[B]OC(=O)C(CCCC)C1CCN(Cc2cccc(OC(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H25BF3NO3.2ClH/c1-2-3-7-17(18(25)27-20)15-8-10-24(11-9-15)13-14-5-4-6-16(12-14)26-19(21,22)23;;/h4-6,12,15,17H,2-3,7-11,13H2,1H3;2*1H |
| InChIKey | XFFSICYQKAHZKC-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.14 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|