C19H25BN2O2 — CID 174927920
CID 174927920 (PubChem CID 174927920) has the molecular formula C19H25BN2O2 and a molecular weight of 324.23 g/mol.
| Compound Name | CID 174927920 |
|---|---|
| PubChem CID | 174927920 |
| Molecular Formula | C19H25BN2O2 |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | — |
| SMILES | [B]OC(=O)C(CCCC)C1CCN(Cc2cccc(C#N)c2)CC1 |
| InChI | InChI=1S/C19H25BN2O2/c1-2-3-7-18(19(23)24-20)17-8-10-22(11-9-17)14-16-6-4-5-15(12-16)13-21/h4-6,12,17-18H,2-3,7-11,14H2,1H3 |
| InChIKey | SIVOTYJPXHEPTJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|