About 2-[1-(naphthalen-2-ylmethyl)piperidin-4-yl]hexanoic acid;dihydrochloride
2-[1-(naphthalen-2-ylmethyl)piperidin-4-yl]hexanoic acid;dihydrochloride (PubChem CID 142749256) has the molecular formula C22H31Cl2NO2
and a molecular weight of 412.40 g/mol. Its IUPAC name is 2-[1-(naphthalen-2-ylmethyl)piperidin-4-yl]hexanoic acid;dihydrochloride.
Molecular Properties
| Compound Name | 2-[1-(naphthalen-2-ylmethyl)piperidin-4-yl]hexanoic acid;dihydrochloride |
| PubChem CID | 142749256 |
| Molecular Formula | C22H31Cl2NO2 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 2-[1-(naphthalen-2-ylmethyl)piperidin-4-yl]hexanoic acid;dihydrochloride |
| SMILES | CCCCC(C(=O)O)C1CCN(Cc2ccc3ccccc3c2)CC1.Cl.Cl |
| InChI | InChI=1S/C22H29NO2.2ClH/c1-2-3-8-21(22(24)25)19-11-13-23(14-12-19)16-17-9-10-18-6-4-5-7-20(18)15-17;;/h4-7,9-10,15,19,21H,2-3,8,11-14,16H2,1H3,(H,24,25);2*1H |
| InChIKey | GLTXLAQMYOIWBE-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[1-(naphthalen-2-ylmethyl)piperidin-4-yl]hexanoic acid;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(naphthalen-2-ylmethyl)piperidin-4-yl]hexanoic acid;dihydrochloride?
The IUPAC name of 2-[1-(naphthalen-2-ylmethyl)piperidin-4-yl]hexanoic acid;dihydrochloride (CID 142749256) is 2-[1-(naphthalen-2-ylmethyl)piperidin-4-yl]hexanoic acid;dihydrochloride.
What is the SMILES notation for 2-[1-(naphthalen-2-ylmethyl)piperidin-4-yl]hexanoic acid;dihydrochloride?
The canonical SMILES for 2-[1-(naphthalen-2-ylmethyl)piperidin-4-yl]hexanoic acid;dihydrochloride is CCCCC(C(=O)O)C1CCN(Cc2ccc3ccccc3c2)CC1.Cl.Cl.
What is the InChIKey of 2-[1-(naphthalen-2-ylmethyl)piperidin-4-yl]hexanoic acid;dihydrochloride?
The InChIKey is GLTXLAQMYOIWBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29NO2.2ClH/c1-2-3-8-21(22(24)25)19-11-13-23(14-12-19)16-17-9-10-18-6-4-5-7-20(18)15-17;;/h4-7,9-10,15,19,21H,2-3,8,11-14,16H2,1H3,(H,24,25);2*1H.
What are the key properties of 2-[1-(naphthalen-2-ylmethyl)piperidin-4-yl]hexanoic acid;dihydrochloride?
2-[1-(naphthalen-2-ylmethyl)piperidin-4-yl]hexanoic acid;dihydrochloride has a molecular weight of 412.40 g/mol, XLogP of 5.79, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(naphthalen-2-ylmethyl)piperidin-4-yl]hexanoic acid;dihydrochloride is sourced from PubChem (CID 142749256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).