C20H29BN2O2 — CID 174927847
CID 174927847 (PubChem CID 174927847) has the molecular formula C20H29BN2O2 and a molecular weight of 340.28 g/mol.
| Compound Name | CID 174927847 |
|---|---|
| PubChem CID | 174927847 |
| Molecular Formula | C20H29BN2O2 |
| Molecular Weight | 340.28 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | — |
| SMILES | [B]OC(=O)C(CCCC)C1CCN(Cc2cccc3c2NCC3)CC1 |
| InChI | InChI=1S/C20H29BN2O2/c1-2-3-7-18(20(24)25-21)15-9-12-23(13-10-15)14-17-6-4-5-16-8-11-22-19(16)17/h4-6,15,18,22H,2-3,7-14H2,1H3 |
| InChIKey | PIYPURHPYWKZEV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.28 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|