C21H23F3N2O2 — CID 167874854
4-[[[1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]amino]methyl]benzoic acid (PubChem CID 167874854) has the molecular formula C21H23F3N2O2 and a molecular weight of 392.42 g/mol. Its IUPAC name is 4-[[[1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]amino]methyl]benzoic acid.
| Compound Name | 4-[[[1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 167874854 |
| Molecular Formula | C21H23F3N2O2 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 4-[[[1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]amino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNC2CCN(Cc3cccc(C(F)(F)F)c3)CC2)cc1 |
| InChI | InChI=1S/C21H23F3N2O2/c22-21(23,24)18-3-1-2-16(12-18)14-26-10-8-19(9-11-26)25-13-15-4-6-17(7-5-15)20(27)28/h1-7,12,19,25H,8-11,13-14H2,(H,27,28) |
| InChIKey | RKBNUNAGFKLTGS-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |