C28H29F3N2O — CID 42850871
4-[(4-benzylpiperidin-1-yl)methyl]-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide (PubChem CID 42850871) has the molecular formula C28H29F3N2O and a molecular weight of 466.55 g/mol. Its IUPAC name is 4-[(4-benzylpiperidin-1-yl)methyl]-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide.
| Compound Name | 4-[(4-benzylpiperidin-1-yl)methyl]-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 42850871 |
| Molecular Formula | C28H29F3N2O |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 4-[(4-benzylpiperidin-1-yl)methyl]-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1cccc(C(F)(F)F)c1)c1ccc(CN2CCC(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C28H29F3N2O/c29-28(30,31)26-8-4-7-24(18-26)19-32-27(34)25-11-9-23(10-12-25)20-33-15-13-22(14-16-33)17-21-5-2-1-3-6-21/h1-12,18,22H,13-17,19-20H2,(H,32,34) |
| InChIKey | VHFYPCAWFMUHHF-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |