C15H12F3NOS — CID 107020234
4-sulfanyl-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide (PubChem CID 107020234) has the molecular formula C15H12F3NOS and a molecular weight of 311.33 g/mol. Its IUPAC name is 4-sulfanyl-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide.
| Compound Name | 4-sulfanyl-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 107020234 |
| Molecular Formula | C15H12F3NOS |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 4-sulfanyl-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1cccc(C(F)(F)F)c1)c1ccc(S)cc1 |
| InChI | InChI=1S/C15H12F3NOS/c16-15(17,18)12-3-1-2-10(8-12)9-19-14(20)11-4-6-13(21)7-5-11/h1-8,21H,9H2,(H,19,20) |
| InChIKey | RGBWJFOSXQNPMZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|