C16H11F3N2O — CID 18291756
4-cyano-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide (PubChem CID 18291756) has the molecular formula C16H11F3N2O and a molecular weight of 304.27 g/mol. Its IUPAC name is 4-cyano-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide.
| Compound Name | 4-cyano-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 18291756 |
| Molecular Formula | C16H11F3N2O |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 4-cyano-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide |
| SMILES | N#Cc1ccc(C(=O)NCc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C16H11F3N2O/c17-16(18,19)14-3-1-2-12(8-14)10-21-15(22)13-6-4-11(9-20)5-7-13/h1-8H,10H2,(H,21,22) |
| InChIKey | IOYCKBHMXUXUMH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |