C21H17F3N2O3S — CID 2105846
4-(phenylsulfamoyl)-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide (PubChem CID 2105846) has the molecular formula C21H17F3N2O3S and a molecular weight of 434.44 g/mol. Its IUPAC name is 4-(phenylsulfamoyl)-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide.
| Compound Name | 4-(phenylsulfamoyl)-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 2105846 |
| Molecular Formula | C21H17F3N2O3S |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 4-(phenylsulfamoyl)-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1cccc(C(F)(F)F)c1)c1ccc(S(=O)(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C21H17F3N2O3S/c22-21(23,24)17-6-4-5-15(13-17)14-25-20(27)16-9-11-19(12-10-16)30(28,29)26-18-7-2-1-3-8-18/h1-13,26H,14H2,(H,25,27) |
| InChIKey | VVFQKDWDZFWMKM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |