C22H28F3N3O3S — CID 27231354
N-[2-[di(propan-2-yl)amino]ethyl]-4-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzamide (PubChem CID 27231354) has the molecular formula C22H28F3N3O3S and a molecular weight of 471.55 g/mol. Its IUPAC name is N-[2-[di(propan-2-yl)amino]ethyl]-4-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzamide.
| Compound Name | N-[2-[di(propan-2-yl)amino]ethyl]-4-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzamide |
|---|---|
| PubChem CID | 27231354 |
| Molecular Formula | C22H28F3N3O3S |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | N-[2-[di(propan-2-yl)amino]ethyl]-4-[[3-(trifluoromethyl)phenyl]sulfamoyl]benzamide |
| SMILES | CC(C)N(CCNC(=O)c1ccc(S(=O)(=O)Nc2cccc(C(F)(F)F)c2)cc1)C(C)C |
| InChI | InChI=1S/C22H28F3N3O3S/c1-15(2)28(16(3)4)13-12-26-21(29)17-8-10-20(11-9-17)32(30,31)27-19-7-5-6-18(14-19)22(23,24)25/h5-11,14-16,27H,12-13H2,1-4H3,(H,26,29) |
| InChIKey | JDEHTFVMPSPVGM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |