C22H31N3O4S — CID 25466941
N-[2-[di(propan-2-yl)amino]ethyl]-4-[(4-methoxyphenyl)sulfamoyl]benzamide (PubChem CID 25466941) has the molecular formula C22H31N3O4S and a molecular weight of 433.57 g/mol. Its IUPAC name is N-[2-[di(propan-2-yl)amino]ethyl]-4-[(4-methoxyphenyl)sulfamoyl]benzamide.
| Compound Name | N-[2-[di(propan-2-yl)amino]ethyl]-4-[(4-methoxyphenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 25466941 |
| Molecular Formula | C22H31N3O4S |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | N-[2-[di(propan-2-yl)amino]ethyl]-4-[(4-methoxyphenyl)sulfamoyl]benzamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(C(=O)NCCN(C(C)C)C(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H31N3O4S/c1-16(2)25(17(3)4)15-14-23-22(26)18-6-12-21(13-7-18)30(27,28)24-19-8-10-20(29-5)11-9-19/h6-13,16-17,24H,14-15H2,1-5H3,(H,23,26) |
| InChIKey | SXZZVXHVICKHDI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |