C22H21FN2O5S — CID 55655448
4-[(4-fluorophenyl)sulfamoyl]-N-[2-hydroxy-2-(4-methoxyphenyl)ethyl]benzamide (PubChem CID 55655448) has the molecular formula C22H21FN2O5S and a molecular weight of 444.48 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)sulfamoyl]-N-[2-hydroxy-2-(4-methoxyphenyl)ethyl]benzamide.
| Compound Name | 4-[(4-fluorophenyl)sulfamoyl]-N-[2-hydroxy-2-(4-methoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 55655448 |
| Molecular Formula | C22H21FN2O5S |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | 4-[(4-fluorophenyl)sulfamoyl]-N-[2-hydroxy-2-(4-methoxyphenyl)ethyl]benzamide |
| SMILES | COc1ccc(C(O)CNC(=O)c2ccc(S(=O)(=O)Nc3ccc(F)cc3)cc2)cc1 |
| InChI | InChI=1S/C22H21FN2O5S/c1-30-19-10-2-15(3-11-19)21(26)14-24-22(27)16-4-12-20(13-5-16)31(28,29)25-18-8-6-17(23)7-9-18/h2-13,21,25-26H,14H2,1H3,(H,24,27) |
| InChIKey | DFBRUBRMGKBPKS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |