C21H20FN3O3S — CID 7950665
4-[(Z)-N-(4-fluoroanilino)-C-methylcarbonimidoyl]-N-(4-methoxyphenyl)benzenesulfonamide (PubChem CID 7950665) has the molecular formula C21H20FN3O3S and a molecular weight of 413.47 g/mol. Its IUPAC name is 4-[(Z)-N-(4-fluoroanilino)-C-methylcarbonimidoyl]-N-(4-methoxyphenyl)benzenesulfonamide.
| Compound Name | 4-[(Z)-N-(4-fluoroanilino)-C-methylcarbonimidoyl]-N-(4-methoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 7950665 |
| Molecular Formula | C21H20FN3O3S |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 4-[(Z)-N-(4-fluoroanilino)-C-methylcarbonimidoyl]-N-(4-methoxyphenyl)benzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(/C(C)=N\Nc3ccc(F)cc3)cc2)cc1 |
| InChI | InChI=1S/C21H20FN3O3S/c1-15(23-24-18-7-5-17(22)6-8-18)16-3-13-21(14-4-16)29(26,27)25-19-9-11-20(28-2)12-10-19/h3-14,24-25H,1-2H3/b23-15- |
| InChIKey | XROHHQUYNLYGCN-HAHDFKILSA-N |
| XLogP | 4.47 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|