C25H28N4O7S — CID 75409663
N-[(E)-1-(4-methoxyphenyl)ethylideneamino]-4-[(2Z)-2-[1-(4-methoxyphenyl)ethylidene]hydrazinyl]benzamide;sulfuric acid (PubChem CID 75409663) has the molecular formula C25H28N4O7S and a molecular weight of 528.59 g/mol. Its IUPAC name is N-[(E)-1-(4-methoxyphenyl)ethylideneamino]-4-[(2Z)-2-[1-(4-methoxyphenyl)ethylidene]hydrazinyl]benzamide;sulfuric acid.
| Compound Name | N-[(E)-1-(4-methoxyphenyl)ethylideneamino]-4-[(2Z)-2-[1-(4-methoxyphenyl)ethylidene]hydrazinyl]benzamide;sulfuric acid |
|---|---|
| PubChem CID | 75409663 |
| Molecular Formula | C25H28N4O7S |
| Molecular Weight | 528.59 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | N-[(E)-1-(4-methoxyphenyl)ethylideneamino]-4-[(2Z)-2-[1-(4-methoxyphenyl)ethylidene]hydrazinyl]benzamide;sulfuric acid |
| SMILES | COc1ccc(/C(C)=N\Nc2ccc(C(=O)N/N=C(\C)c3ccc(OC)cc3)cc2)cc1.O=S(=O)(O)O |
| InChI | InChI=1S/C25H26N4O3.H2O4S/c1-17(19-7-13-23(31-3)14-8-19)26-28-22-11-5-21(6-12-22)25(30)29-27-18(2)20-9-15-24(32-4)16-10-20;1-5(2,3)4/h5-16,28H,1-4H3,(H,29,30);(H2,1,2,3,4)/b26-17-,27-18+; |
| InChIKey | RCMDUWRAKBEUPO-NBXMBKIVSA-N |
| XLogP | 4.04 |
| TPSA | 158.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.59 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|