C23H22Cl2N4O5S — CID 75409654
N-[(Z)-1-(2-chlorophenyl)ethylideneamino]-4-[(2Z)-2-[1-(2-chlorophenyl)ethylidene]hydrazinyl]benzamide;sulfuric acid (PubChem CID 75409654) has the molecular formula C23H22Cl2N4O5S and a molecular weight of 537.43 g/mol. Its IUPAC name is N-[(Z)-1-(2-chlorophenyl)ethylideneamino]-4-[(2Z)-2-[1-(2-chlorophenyl)ethylidene]hydrazinyl]benzamide;sulfuric acid.
| Compound Name | N-[(Z)-1-(2-chlorophenyl)ethylideneamino]-4-[(2Z)-2-[1-(2-chlorophenyl)ethylidene]hydrazinyl]benzamide;sulfuric acid |
|---|---|
| PubChem CID | 75409654 |
| Molecular Formula | C23H22Cl2N4O5S |
| Molecular Weight | 537.43 g/mol |
| Exact Mass | 536.07 |
| IUPAC Name | N-[(Z)-1-(2-chlorophenyl)ethylideneamino]-4-[(2Z)-2-[1-(2-chlorophenyl)ethylidene]hydrazinyl]benzamide;sulfuric acid |
| SMILES | C/C(=N/NC(=O)c1ccc(N/N=C(/C)c2ccccc2Cl)cc1)c1ccccc1Cl.O=S(=O)(O)O |
| InChI | InChI=1S/C23H20Cl2N4O.H2O4S/c1-15(19-7-3-5-9-21(19)24)26-28-18-13-11-17(12-14-18)23(30)29-27-16(2)20-8-4-6-10-22(20)25;1-5(2,3)4/h3-14,28H,1-2H3,(H,29,30);(H2,1,2,3,4)/b26-15-,27-16-; |
| InChIKey | SKLUATPQXFHQMD-MBDUUULYSA-N |
| XLogP | 5.33 |
| TPSA | 140.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.43 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|