C31H28N4O5S — CID 75409659
N-[(Z)-1-naphthalen-2-ylethylideneamino]-4-[(2Z)-2-(1-naphthalen-2-ylethylidene)hydrazinyl]benzamide;sulfuric acid (PubChem CID 75409659) has the molecular formula C31H28N4O5S and a molecular weight of 568.66 g/mol. Its IUPAC name is N-[(Z)-1-naphthalen-2-ylethylideneamino]-4-[(2Z)-2-(1-naphthalen-2-ylethylidene)hydrazinyl]benzamide;sulfuric acid.
| Compound Name | N-[(Z)-1-naphthalen-2-ylethylideneamino]-4-[(2Z)-2-(1-naphthalen-2-ylethylidene)hydrazinyl]benzamide;sulfuric acid |
|---|---|
| PubChem CID | 75409659 |
| Molecular Formula | C31H28N4O5S |
| Molecular Weight | 568.66 g/mol |
| Exact Mass | 568.18 |
| IUPAC Name | N-[(Z)-1-naphthalen-2-ylethylideneamino]-4-[(2Z)-2-(1-naphthalen-2-ylethylidene)hydrazinyl]benzamide;sulfuric acid |
| SMILES | C/C(=N/NC(=O)c1ccc(N/N=C(/C)c2ccc3ccccc3c2)cc1)c1ccc2ccccc2c1.O=S(=O)(O)O |
| InChI | InChI=1S/C31H26N4O.H2O4S/c1-21(26-13-11-23-7-3-5-9-28(23)19-26)32-34-30-17-15-25(16-18-30)31(36)35-33-22(2)27-14-12-24-8-4-6-10-29(24)20-27;1-5(2,3)4/h3-20,34H,1-2H3,(H,35,36);(H2,1,2,3,4)/b32-21-,33-22-; |
| InChIKey | XHEOEZCOOHFTEJ-SPOIIMDXSA-N |
| XLogP | 6.33 |
| TPSA | 140.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.66 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_naphth_A(5)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|