C15H10Cl4N2O — CID 3997107
2-chloro-N-[1-(2,3,4-trichlorophenyl)ethylideneamino]benzamide (PubChem CID 3997107) has the molecular formula C15H10Cl4N2O and a molecular weight of 376.07 g/mol. Its IUPAC name is 2-chloro-N-[1-(2,3,4-trichlorophenyl)ethylideneamino]benzamide.
| Compound Name | 2-chloro-N-[1-(2,3,4-trichlorophenyl)ethylideneamino]benzamide |
|---|---|
| PubChem CID | 3997107 |
| Molecular Formula | C15H10Cl4N2O |
| Molecular Weight | 376.07 g/mol |
| Exact Mass | 373.95 |
| IUPAC Name | 2-chloro-N-[1-(2,3,4-trichlorophenyl)ethylideneamino]benzamide |
| SMILES | CC(=NNC(=O)c1ccccc1Cl)c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C15H10Cl4N2O/c1-8(9-6-7-12(17)14(19)13(9)18)20-21-15(22)10-4-2-3-5-11(10)16/h2-7H,1H3,(H,21,22) |
| InChIKey | YUBPXELDVBIVQW-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.07 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|