C13H17ClN2O — CID 691089
2-chloro-N-(3,3-dimethylbutan-2-ylideneamino)benzamide (PubChem CID 691089) has the molecular formula C13H17ClN2O and a molecular weight of 252.75 g/mol. Its IUPAC name is 2-chloro-N-(3,3-dimethylbutan-2-ylideneamino)benzamide.
| Compound Name | 2-chloro-N-(3,3-dimethylbutan-2-ylideneamino)benzamide |
|---|---|
| PubChem CID | 691089 |
| Molecular Formula | C13H17ClN2O |
| Molecular Weight | 252.75 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 2-chloro-N-(3,3-dimethylbutan-2-ylideneamino)benzamide |
| SMILES | CC(=NNC(=O)c1ccccc1Cl)C(C)(C)C |
| InChI | InChI=1S/C13H17ClN2O/c1-9(13(2,3)4)15-16-12(17)10-7-5-6-8-11(10)14/h5-8H,1-4H3,(H,16,17) |
| InChIKey | MWFYOANCZCXXKC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.75 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|