C22H23N3O4S — CID 121473240
4-[(Z)-N-(4-methoxyanilino)-C-methylcarbonimidoyl]-N-(4-methoxyphenyl)benzenesulfonamide (PubChem CID 121473240) has the molecular formula C22H23N3O4S and a molecular weight of 425.51 g/mol. Its IUPAC name is 4-[(Z)-N-(4-methoxyanilino)-C-methylcarbonimidoyl]-N-(4-methoxyphenyl)benzenesulfonamide.
| Compound Name | 4-[(Z)-N-(4-methoxyanilino)-C-methylcarbonimidoyl]-N-(4-methoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 121473240 |
| Molecular Formula | C22H23N3O4S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 4-[(Z)-N-(4-methoxyanilino)-C-methylcarbonimidoyl]-N-(4-methoxyphenyl)benzenesulfonamide |
| SMILES | COc1ccc(N/N=C(/C)c2ccc(S(=O)(=O)Nc3ccc(OC)cc3)cc2)cc1 |
| InChI | InChI=1S/C22H23N3O4S/c1-16(23-24-18-6-10-20(28-2)11-7-18)17-4-14-22(15-5-17)30(26,27)25-19-8-12-21(29-3)13-9-19/h4-15,24-25H,1-3H3/b23-16- |
| InChIKey | RWXPSPVGIKVYDG-KQWNVCNZSA-N |
| XLogP | 4.34 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|